C41H51NO8Si2 — CID 10952748
[(3aS,6R,6aS)-3a,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl] nitrate (PubChem CID 10952748) has the molecular formula C41H51NO8Si2 and a molecular weight of 742.03 g/mol. Its IUPAC name is [(3aS,6R,6aS)-3a,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl] nitrate.
| Compound Name | [(3aS,6R,6aS)-3a,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl] nitrate |
|---|---|
| PubChem CID | 10952748 |
| Molecular Formula | C41H51NO8Si2 |
| Molecular Weight | 742.03 g/mol |
| Exact Mass | 741.32 |
| IUPAC Name | [(3aS,6R,6aS)-3a,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl] nitrate |
| SMILES | CC1(C)O[C@H]2[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(O[N+](=O)[O-])[C@@]2(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C41H51NO8Si2/c1-38(2,3)51(31-21-13-9-14-22-31,32-23-15-10-16-24-32)45-29-35-36-41(50-40(7,8)48-36,37(47-35)49-42(43)44)30-46-52(39(4,5)6,33-25-17-11-18-26-33)34-27-19-12-20-28-34/h9-28,35-37H,29-30H2,1-8H3/t35-,36+,37?,41+/m1/s1 |
| InChIKey | XPOURWLILYNSSU-MYDYHXETSA-N |
| XLogP | 5.96 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.03 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|