C27H35NO4Si — CID 59796271
2-[(3aS,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]acetonitrile (PubChem CID 59796271) has the molecular formula C27H35NO4Si and a molecular weight of 465.67 g/mol. Its IUPAC name is 2-[(3aS,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]acetonitrile.
| Compound Name | 2-[(3aS,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 59796271 |
| Molecular Formula | C27H35NO4Si |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 2-[(3aS,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]acetonitrile |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(CC#N)[C@]2(C)O1 |
| InChI | InChI=1S/C27H35NO4Si/c1-25(2,3)33(20-13-9-7-10-14-20,21-15-11-8-12-16-21)29-19-22-24-27(6,23(30-22)17-18-28)32-26(4,5)31-24/h7-16,22-24H,17,19H2,1-6H3/t22-,23?,24-,27+/m1/s1 |
| InChIKey | CIHDZRNZGPQBGK-GALFYAKASA-N |
| XLogP | 4.15 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|