C28H39NO7Si — CID 102401447
tert-butyl-[[(4R,5S)-5-(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane (PubChem CID 102401447) has the molecular formula C28H39NO7Si and a molecular weight of 529.71 g/mol. Its IUPAC name is tert-butyl-[[(4R,5S)-5-(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(4R,5S)-5-(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102401447 |
| Molecular Formula | C28H39NO7Si |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | tert-butyl-[[(4R,5S)-5-(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane |
| SMILES | CC1(C)OCC([C@@H]2OC(C)(C)O[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)([N+](=O)[O-])CO1 |
| InChI | InChI=1S/C28H39NO7Si/c1-25(2,3)37(21-14-10-8-11-15-21,22-16-12-9-13-17-22)34-18-23-24(36-27(6,7)35-23)28(29(30)31)19-32-26(4,5)33-20-28/h8-17,23-24H,18-20H2,1-7H3/t23-,24-/m1/s1 |
| InChIKey | XIOKRNXRIZDGQR-DNQXCXABSA-N |
| XLogP | 3.88 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|