C31H43BrO4Si — CID 102388175
[(2S,3S)-3-[2-[(2S,3R)-3-[2-[(2S,3R)-3-(bromomethyl)-3-methyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 102388175) has the molecular formula C31H43BrO4Si and a molecular weight of 587.67 g/mol. Its IUPAC name is [(2S,3S)-3-[2-[(2S,3R)-3-[2-[(2S,3R)-3-(bromomethyl)-3-methyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3S)-3-[2-[(2S,3R)-3-[2-[(2S,3R)-3-(bromomethyl)-3-methyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 102388175 |
| Molecular Formula | C31H43BrO4Si |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | [(2S,3S)-3-[2-[(2S,3R)-3-[2-[(2S,3R)-3-(bromomethyl)-3-methyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1O[C@@]1(C)CC[C@@H]1O[C@]1(C)CC[C@@H]1O[C@@]1(C)CBr)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H43BrO4Si/c1-28(2,3)37(23-13-9-7-10-14-23,24-15-11-8-12-16-24)33-21-27-30(5,36-27)20-17-25-29(4,34-25)19-18-26-31(6,22-32)35-26/h7-16,25-27H,17-22H2,1-6H3/t25-,26-,27-,29+,30-,31-/m0/s1 |
| InChIKey | PVKSICAELTYQLK-REAXHMBQSA-N |
| XLogP | 5.99 |
| TPSA | 46.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|