C32H50O6Si2 — CID 11671518
[(4R,5R)-5-[(E,1S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(2-trimethylsilylethoxymethoxy)but-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 11671518) has the molecular formula C32H50O6Si2 and a molecular weight of 586.92 g/mol. Its IUPAC name is [(4R,5R)-5-[(E,1S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(2-trimethylsilylethoxymethoxy)but-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5R)-5-[(E,1S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(2-trimethylsilylethoxymethoxy)but-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 11671518 |
| Molecular Formula | C32H50O6Si2 |
| Molecular Weight | 586.92 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | [(4R,5R)-5-[(E,1S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(2-trimethylsilylethoxymethoxy)but-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)O[C@@H]([C@H](/C=C/COCOCC[Si](C)(C)C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CO)O1 |
| InChI | InChI=1S/C32H50O6Si2/c1-31(2,3)40(26-16-11-9-12-17-26,27-18-13-10-14-19-27)38-28(30-29(24-33)36-32(4,5)37-30)20-15-21-34-25-35-22-23-39(6,7)8/h9-20,28-30,33H,21-25H2,1-8H3/b20-15+/t28-,29+,30-/m0/s1 |
| InChIKey | RGCNGQQPDLPRMY-XMWNBEQSSA-N |
| XLogP | 5.33 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.92 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|