C39H54O4Si2 — CID 66560084
tert-butyl-diphenyl-[(1R,3E,6Z,8R)-1-(3-phenyloxiran-2-yl)-8-(2-trimethylsilylethoxymethoxy)nona-3,6-dienoxy]silane (PubChem CID 66560084) has the molecular formula C39H54O4Si2 and a molecular weight of 643.03 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(1R,3E,6Z,8R)-1-(3-phenyloxiran-2-yl)-8-(2-trimethylsilylethoxymethoxy)nona-3,6-dienoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(1R,3E,6Z,8R)-1-(3-phenyloxiran-2-yl)-8-(2-trimethylsilylethoxymethoxy)nona-3,6-dienoxy]silane |
|---|---|
| PubChem CID | 66560084 |
| Molecular Formula | C39H54O4Si2 |
| Molecular Weight | 643.03 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | tert-butyl-diphenyl-[(1R,3E,6Z,8R)-1-(3-phenyloxiran-2-yl)-8-(2-trimethylsilylethoxymethoxy)nona-3,6-dienoxy]silane |
| SMILES | C[C@H](/C=C\C/C=C/C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1OC1c1ccccc1)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C39H54O4Si2/c1-32(41-31-40-29-30-44(5,6)7)21-13-8-9-20-28-36(38-37(42-38)33-22-14-10-15-23-33)43-45(39(2,3)4,34-24-16-11-17-25-34)35-26-18-12-19-27-35/h9-27,32,36-38H,8,28-31H2,1-7H3/b20-9+,21-13-/t32-,36-,37?,38?/m1/s1 |
| InChIKey | ZQIPHXPETFSITI-LPSIASMMSA-N |
| XLogP | 8.68 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.03 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|