C43H77BrO5Si4 — CID 101395991
2-[[(E,2R,3R,5R)-7-bromo-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-9-[tert-butyl(diphenyl)silyl]oxynon-7-en-3-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 101395991) has the molecular formula C43H77BrO5Si4 and a molecular weight of 866.33 g/mol. Its IUPAC name is 2-[[(E,2R,3R,5R)-7-bromo-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-9-[tert-butyl(diphenyl)silyl]oxynon-7-en-3-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(E,2R,3R,5R)-7-bromo-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-9-[tert-butyl(diphenyl)silyl]oxynon-7-en-3-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 101395991 |
| Molecular Formula | C43H77BrO5Si4 |
| Molecular Weight | 866.33 g/mol |
| Exact Mass | 864.40 |
| IUPAC Name | 2-[[(E,2R,3R,5R)-7-bromo-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-9-[tert-butyl(diphenyl)silyl]oxynon-7-en-3-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C[C@H](C/C(Br)=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C43H77BrO5Si4/c1-35(48-51(14,15)41(2,3)4)40(46-34-45-30-31-50(11,12)13)33-37(49-52(16,17)42(5,6)7)32-36(44)28-29-47-53(43(8,9)10,38-24-20-18-21-25-38)39-26-22-19-23-27-39/h18-28,35,37,40H,29-34H2,1-17H3/b36-28+/t35-,37+,40-/m1/s1 |
| InChIKey | ORHLDWUZESDBPU-UWZYVFQESA-N |
| XLogP | 12.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.33 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|