C44H57IO8Si — CID 11147284
tert-butyl-[(E,5R,7R,8R)-5-[(3,4-dimethoxyphenyl)methoxy]-3-iodo-8-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]non-2-enoxy]-diphenylsilane (PubChem CID 11147284) has the molecular formula C44H57IO8Si and a molecular weight of 868.92 g/mol. Its IUPAC name is tert-butyl-[(E,5R,7R,8R)-5-[(3,4-dimethoxyphenyl)methoxy]-3-iodo-8-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]non-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E,5R,7R,8R)-5-[(3,4-dimethoxyphenyl)methoxy]-3-iodo-8-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]non-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11147284 |
| Molecular Formula | C44H57IO8Si |
| Molecular Weight | 868.92 g/mol |
| Exact Mass | 868.29 |
| IUPAC Name | tert-butyl-[(E,5R,7R,8R)-5-[(3,4-dimethoxyphenyl)methoxy]-3-iodo-8-(methoxymethoxy)-7-[(4-methoxyphenyl)methoxy]non-2-enoxy]-diphenylsilane |
| SMILES | COCO[C@H](C)[C@@H](C[C@H](C/C(I)=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccc(OC)c(OC)c1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C44H57IO8Si/c1-33(52-32-46-5)42(51-30-34-19-22-37(47-6)23-20-34)29-38(50-31-35-21-24-41(48-7)43(27-35)49-8)28-36(45)25-26-53-54(44(2,3)4,39-15-11-9-12-16-39)40-17-13-10-14-18-40/h9-25,27,33,38,42H,26,28-32H2,1-8H3/b36-25+/t33-,38+,42-/m1/s1 |
| InChIKey | PBZBGFBGFYVYDR-XISJXOAQSA-N |
| XLogP | 8.87 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.92 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|