C28H42O5Si — CID 11799151
(2S,3R,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methoxyethoxymethoxy)hept-6-en-2-ol (PubChem CID 11799151) has the molecular formula C28H42O5Si and a molecular weight of 486.73 g/mol. Its IUPAC name is (2S,3R,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methoxyethoxymethoxy)hept-6-en-2-ol.
| Compound Name | (2S,3R,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methoxyethoxymethoxy)hept-6-en-2-ol |
|---|---|
| PubChem CID | 11799151 |
| Molecular Formula | C28H42O5Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (2S,3R,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methoxyethoxymethoxy)hept-6-en-2-ol |
| SMILES | C=CC[C@H](OCOCCOC)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)O |
| InChI | InChI=1S/C28H42O5Si/c1-7-14-27(32-22-31-20-19-30-6)26(23(2)29)21-33-34(28(3,4)5,24-15-10-8-11-16-24)25-17-12-9-13-18-25/h7-13,15-18,23,26-27,29H,1,14,19-22H2,2-6H3/t23-,26+,27-/m0/s1 |
| InChIKey | YCKVKHFQVOXYCC-RNJDCESWSA-N |
| XLogP | 4.14 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|