C23H29NO3Si — CID 70226546
(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxyoxolane-3-carbonitrile (PubChem CID 70226546) has the molecular formula C23H29NO3Si and a molecular weight of 395.58 g/mol. Its IUPAC name is (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxyoxolane-3-carbonitrile.
| Compound Name | (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxyoxolane-3-carbonitrile |
|---|---|
| PubChem CID | 70226546 |
| Molecular Formula | C23H29NO3Si |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxyoxolane-3-carbonitrile |
| SMILES | COC1C[C@H](C#N)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H29NO3Si/c1-23(2,3)28(19-11-7-5-8-12-19,20-13-9-6-10-14-20)26-17-21-18(16-24)15-22(25-4)27-21/h5-14,18,21-22H,15,17H2,1-4H3/t18-,21-,22?/m1/s1 |
| InChIKey | ZWPIRNZSLCEEQR-QOCBGMSTSA-N |
| XLogP | 3.46 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|