C29H44O5Si2 — CID 11005929
(4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxypropyl]oxolan-2-one (PubChem CID 11005929) has the molecular formula C29H44O5Si2 and a molecular weight of 528.84 g/mol. Its IUPAC name is (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxypropyl]oxolan-2-one.
| Compound Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxypropyl]oxolan-2-one |
|---|---|
| PubChem CID | 11005929 |
| Molecular Formula | C29H44O5Si2 |
| Molecular Weight | 528.84 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxypropyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)O[C@@H]1[C@@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H44O5Si2/c1-28(2,3)35(7,8)34-25-21-26(31)33-27(25)24(30)19-20-32-36(29(4,5)6,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,24-25,27,30H,19-21H2,1-8H3/t24-,25-,27+/m0/s1 |
| InChIKey | DHJVFKHCOSDYSG-OHSXHVKISA-N |
| XLogP | 5.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|