C28H38O5Si — CID 100945934
(4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-[(2S)-4-(3,3-dimethyloxiran-2-yl)-2-hydroxybutan-2-yl]oxolan-2-one (PubChem CID 100945934) has the molecular formula C28H38O5Si and a molecular weight of 482.69 g/mol. Its IUPAC name is (4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-[(2S)-4-(3,3-dimethyloxiran-2-yl)-2-hydroxybutan-2-yl]oxolan-2-one.
| Compound Name | (4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-[(2S)-4-(3,3-dimethyloxiran-2-yl)-2-hydroxybutan-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 100945934 |
| Molecular Formula | C28H38O5Si |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | (4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-[(2S)-4-(3,3-dimethyloxiran-2-yl)-2-hydroxybutan-2-yl]oxolan-2-one |
| SMILES | CC1(C)OC1CC[C@](C)(O)[C@H]1OC(=O)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H38O5Si/c1-26(2,3)34(20-13-9-7-10-14-20,21-15-11-8-12-16-21)33-22-19-24(29)31-25(22)28(6,30)18-17-23-27(4,5)32-23/h7-16,22-23,25,30H,17-19H2,1-6H3/t22-,23?,25-,28-/m0/s1 |
| InChIKey | QOLYSWOAAKYIGG-SDKJUFGRSA-N |
| XLogP | 3.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|