C31H38O5Si — CID 101041354
methyl (1R,5S,9R,10S,13R)-10-[tert-butyl(diphenyl)silyl]oxy-6-methyl-3-oxo-2-oxatricyclo[7.3.1.05,13]tridec-6-ene-13-carboxylate (PubChem CID 101041354) has the molecular formula C31H38O5Si and a molecular weight of 518.73 g/mol. Its IUPAC name is methyl (1R,5S,9R,10S,13R)-10-[tert-butyl(diphenyl)silyl]oxy-6-methyl-3-oxo-2-oxatricyclo[7.3.1.05,13]tridec-6-ene-13-carboxylate.
| Compound Name | methyl (1R,5S,9R,10S,13R)-10-[tert-butyl(diphenyl)silyl]oxy-6-methyl-3-oxo-2-oxatricyclo[7.3.1.05,13]tridec-6-ene-13-carboxylate |
|---|---|
| PubChem CID | 101041354 |
| Molecular Formula | C31H38O5Si |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | methyl (1R,5S,9R,10S,13R)-10-[tert-butyl(diphenyl)silyl]oxy-6-methyl-3-oxo-2-oxatricyclo[7.3.1.05,13]tridec-6-ene-13-carboxylate |
| SMILES | COC(=O)[C@@]12[C@H]3CC[C@H](O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)[C@@H]1CC=C(C)[C@@H]2CC(=O)O3 |
| InChI | InChI=1S/C31H38O5Si/c1-21-16-17-24-26(18-19-27-31(24,29(33)34-5)25(21)20-28(32)35-27)36-37(30(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-16,24-27H,17-20H2,1-5H3/t24-,25-,26-,27+,31-/m0/s1 |
| InChIKey | LRLGWXLDZATFQX-LUOFYKQISA-N |
| XLogP | 4.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|