C34H40O4Si — CID 23625577
trans-methyl (1R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(2-methylphenyl)-2-oxo-3-propan-2-ylidenecyclohexane-1-carboxylate (PubChem CID 23625577) has the molecular formula C34H40O4Si and a molecular weight of 540.78 g/mol. Its IUPAC name is trans-methyl (1R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(2-methylphenyl)-2-oxo-3-propan-2-ylidenecyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(2-methylphenyl)-2-oxo-3-propan-2-ylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23625577 |
| Molecular Formula | C34H40O4Si |
| Molecular Weight | 540.78 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | trans-methyl (1R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(2-methylphenyl)-2-oxo-3-propan-2-ylidenecyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(c2ccccc2C)C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=C(C)C)C1=O |
| InChI | InChI=1S/C34H40O4Si/c1-24(2)29-22-26(23-34(31(29)35,32(36)37-7)30-21-15-14-16-25(30)3)38-39(33(4,5)6,27-17-10-8-11-18-27)28-19-12-9-13-20-28/h8-21,26H,22-23H2,1-7H3/t26-,34+/m0/s1 |
| InChIKey | YUCFJHNLOJCOPI-UVMFRMCBSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.78 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|