C31H38O4S2Si — CID 101368771
methyl (2R,3aS,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(1,3-dithiolan-2-yl)-8-oxo-2,3,4,5,6,7-hexahydroazulene-3a-carboxylate (PubChem CID 101368771) has the molecular formula C31H38O4S2Si and a molecular weight of 566.86 g/mol. Its IUPAC name is methyl (2R,3aS,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(1,3-dithiolan-2-yl)-8-oxo-2,3,4,5,6,7-hexahydroazulene-3a-carboxylate.
| Compound Name | methyl (2R,3aS,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(1,3-dithiolan-2-yl)-8-oxo-2,3,4,5,6,7-hexahydroazulene-3a-carboxylate |
|---|---|
| PubChem CID | 101368771 |
| Molecular Formula | C31H38O4S2Si |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | methyl (2R,3aS,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-(1,3-dithiolan-2-yl)-8-oxo-2,3,4,5,6,7-hexahydroazulene-3a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CCC(=O)C1=C[C@H](C1SCCS1)C2 |
| InChI | InChI=1S/C31H38O4S2Si/c1-30(2,3)38(24-11-7-5-8-12-24,25-13-9-6-10-14-25)35-23-15-16-27(32)26-19-22(28-36-17-18-37-28)20-31(26,21-23)29(33)34-4/h5-14,19,22-23,28H,15-18,20-21H2,1-4H3/t22-,23-,31-/m0/s1 |
| InChIKey | ACLWDLJFLVOSLC-BVXAZASISA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|