C25H32ClNO4Si — CID 169041374
methyl (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(3-chloro-2-oxopropyl)pyrrolidine-2-carboxylate (PubChem CID 169041374) has the molecular formula C25H32ClNO4Si and a molecular weight of 474.07 g/mol. Its IUPAC name is methyl (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(3-chloro-2-oxopropyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(3-chloro-2-oxopropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 169041374 |
| Molecular Formula | C25H32ClNO4Si |
| Molecular Weight | 474.07 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | methyl (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(3-chloro-2-oxopropyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@]1(CC(=O)CCl)C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN1 |
| InChI | InChI=1S/C25H32ClNO4Si/c1-24(2,3)32(21-11-7-5-8-12-21,22-13-9-6-10-14-22)31-20-16-25(27-18-20,23(29)30-4)15-19(28)17-26/h5-14,20,27H,15-18H2,1-4H3/t20-,25+/m0/s1 |
| InChIKey | WQNDDRCXHVHCBW-NBGIEHNGSA-N |
| XLogP | 3.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.07 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|