C27H34O3Si — CID 11568257
(3aR,4S,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,5-dimethyl-3,4,7,7a-tetrahydro-1-benzofuran-2-one (PubChem CID 11568257) has the molecular formula C27H34O3Si and a molecular weight of 434.65 g/mol. Its IUPAC name is (3aR,4S,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,5-dimethyl-3,4,7,7a-tetrahydro-1-benzofuran-2-one.
| Compound Name | (3aR,4S,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,5-dimethyl-3,4,7,7a-tetrahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 11568257 |
| Molecular Formula | C27H34O3Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (3aR,4S,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3a,5-dimethyl-3,4,7,7a-tetrahydro-1-benzofuran-2-one |
| SMILES | CC1=CC[C@@H]2OC(=O)C[C@]2(C)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H34O3Si/c1-20-16-17-24-27(5,18-25(28)30-24)23(20)19-29-31(26(2,3)4,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-16,23-24H,17-19H2,1-5H3/t23-,24-,27+/m0/s1 |
| InChIKey | WCFOHTOIRWTDLS-NLJOTIRTSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|