C25H32O3Si — CID 23631220
(2S,3aR,6aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6a-methyl-3,3a,4,6-tetrahydro-2H-cyclopenta[b]furan-5-one (PubChem CID 23631220) has the molecular formula C25H32O3Si and a molecular weight of 408.61 g/mol. Its IUPAC name is (2S,3aR,6aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6a-methyl-3,3a,4,6-tetrahydro-2H-cyclopenta[b]furan-5-one.
| Compound Name | (2S,3aR,6aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6a-methyl-3,3a,4,6-tetrahydro-2H-cyclopenta[b]furan-5-one |
|---|---|
| PubChem CID | 23631220 |
| Molecular Formula | C25H32O3Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (2S,3aR,6aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6a-methyl-3,3a,4,6-tetrahydro-2H-cyclopenta[b]furan-5-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H]2CC(=O)C[C@]2(C)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32O3Si/c1-24(2,3)29(22-11-7-5-8-12-22,23-13-9-6-10-14-23)27-18-21-16-19-15-20(26)17-25(19,4)28-21/h5-14,19,21H,15-18H2,1-4H3/t19-,21-,25-/m0/s1 |
| InChIKey | ZYCBBTXESYMBDX-OWHZGTRUSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|