C29H33F3O3Si — CID 123838432
5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2-[4-(trifluoromethyl)phenyl]oxolan-2-ol (PubChem CID 123838432) has the molecular formula C29H33F3O3Si and a molecular weight of 514.66 g/mol. Its IUPAC name is 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2-[4-(trifluoromethyl)phenyl]oxolan-2-ol.
| Compound Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2-[4-(trifluoromethyl)phenyl]oxolan-2-ol |
|---|---|
| PubChem CID | 123838432 |
| Molecular Formula | C29H33F3O3Si |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2-[4-(trifluoromethyl)phenyl]oxolan-2-ol |
| SMILES | CC1CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H33F3O3Si/c1-21-19-24(35-28(21,33)22-15-17-23(18-16-22)29(30,31)32)20-34-36(27(2,3)4,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-18,21,24,33H,19-20H2,1-4H3 |
| InChIKey | ZOJHLJWNZLCWAI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|