C27H39NO3SSi — CID 10917892
S-propyl (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2S,4R)-4-hydroxypyrrolidin-2-yl]butanethioate (PubChem CID 10917892) has the molecular formula C27H39NO3SSi and a molecular weight of 485.77 g/mol. Its IUPAC name is S-propyl (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2S,4R)-4-hydroxypyrrolidin-2-yl]butanethioate.
| Compound Name | S-propyl (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2S,4R)-4-hydroxypyrrolidin-2-yl]butanethioate |
|---|---|
| PubChem CID | 10917892 |
| Molecular Formula | C27H39NO3SSi |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | S-propyl (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2S,4R)-4-hydroxypyrrolidin-2-yl]butanethioate |
| SMILES | CCCSC(=O)[C@H]([C@@H]1C[C@@H](O)CN1)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H39NO3SSi/c1-6-17-32-26(30)25(24-18-21(29)19-28-24)20(2)31-33(27(3,4)5,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,20-21,24-25,28-29H,6,17-19H2,1-5H3/t20-,21+,24-,25-/m0/s1 |
| InChIKey | BQMCBHKSWDOFHB-JQOLTRQRSA-N |
| XLogP | 3.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|