C23H23NO6 — CID 10431628
dimethyl (3R,4S,7S,8R,8aS)-1-oxo-3,4-diphenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate (PubChem CID 10431628) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is dimethyl (3R,4S,7S,8R,8aS)-1-oxo-3,4-diphenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate.
| Compound Name | dimethyl (3R,4S,7S,8R,8aS)-1-oxo-3,4-diphenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 10431628 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | dimethyl (3R,4S,7S,8R,8aS)-1-oxo-3,4-diphenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C(=O)O[C@H](c3ccccc3)[C@H](c3ccccc3)N2C[C@H]1C(=O)OC |
| InChI | InChI=1S/C23H23NO6/c1-28-21(25)16-13-24-18(14-9-5-3-6-10-14)20(15-11-7-4-8-12-15)30-23(27)19(24)17(16)22(26)29-2/h3-12,16-20H,13H2,1-2H3/t16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | IVSWPTCWUIGWQE-SWBPCFCJSA-N |
| XLogP | 2.29 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|