C21H27NO6 — CID 101124660
dimethyl (3S,4R,7R,8S,8aR)-8a-methyl-1-oxo-4-phenyl-3-propan-2-yl-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate (PubChem CID 101124660) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is dimethyl (3S,4R,7R,8S,8aR)-8a-methyl-1-oxo-4-phenyl-3-propan-2-yl-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate.
| Compound Name | dimethyl (3S,4R,7R,8S,8aR)-8a-methyl-1-oxo-4-phenyl-3-propan-2-yl-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 101124660 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | dimethyl (3S,4R,7R,8S,8aR)-8a-methyl-1-oxo-4-phenyl-3-propan-2-yl-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
| SMILES | COC(=O)[C@H]1CN2[C@H](c3ccccc3)[C@H](C(C)C)OC(=O)[C@@]2(C)[C@H]1C(=O)OC |
| InChI | InChI=1S/C21H27NO6/c1-12(2)17-16(13-9-7-6-8-10-13)22-11-14(18(23)26-4)15(19(24)27-5)21(22,3)20(25)28-17/h6-10,12,14-17H,11H2,1-5H3/t14-,15+,16+,17-,21+/m0/s1 |
| InChIKey | IRCXTWHIWXDJDB-PLCHWVDCSA-N |
| XLogP | 1.96 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|