C18H17NO3 — CID 10469773
methyl (3R,4S)-1-benzyl-2-oxo-4-phenylazetidine-3-carboxylate (PubChem CID 10469773) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl (3R,4S)-1-benzyl-2-oxo-4-phenylazetidine-3-carboxylate.
| Compound Name | methyl (3R,4S)-1-benzyl-2-oxo-4-phenylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 10469773 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl (3R,4S)-1-benzyl-2-oxo-4-phenylazetidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c1-22-18(21)15-16(14-10-6-3-7-11-14)19(17(15)20)12-13-8-4-2-5-9-13/h2-11,15-16H,12H2,1H3/t15-,16-/m1/s1 |
| InChIKey | KNUIZUMVIVTJFX-HZPDHXFCSA-N |
| XLogP | 2.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|