C23H25NO3Si — CID 122222549
3-trimethylsilylprop-2-ynyl 1-benzyl-2-oxo-4-phenylazetidine-3-carboxylate (PubChem CID 122222549) has the molecular formula C23H25NO3Si and a molecular weight of 391.54 g/mol. Its IUPAC name is 3-trimethylsilylprop-2-ynyl 1-benzyl-2-oxo-4-phenylazetidine-3-carboxylate.
| Compound Name | 3-trimethylsilylprop-2-ynyl 1-benzyl-2-oxo-4-phenylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 122222549 |
| Molecular Formula | C23H25NO3Si |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-trimethylsilylprop-2-ynyl 1-benzyl-2-oxo-4-phenylazetidine-3-carboxylate |
| SMILES | C[Si](C)(C)C#CCOC(=O)C1C(=O)N(Cc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C23H25NO3Si/c1-28(2,3)16-10-15-27-23(26)20-21(19-13-8-5-9-14-19)24(22(20)25)17-18-11-6-4-7-12-18/h4-9,11-14,20-21H,15,17H2,1-3H3 |
| InChIKey | UNHQZIODNNVYLX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|