C17H19NO6 — CID 11759398
dimethyl 1-benzyl-4-ethoxy-5-oxo-2H-pyrrole-2,3-dicarboxylate (PubChem CID 11759398) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is dimethyl 1-benzyl-4-ethoxy-5-oxo-2H-pyrrole-2,3-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-4-ethoxy-5-oxo-2H-pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11759398 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | dimethyl 1-benzyl-4-ethoxy-5-oxo-2H-pyrrole-2,3-dicarboxylate |
| SMILES | CCOC1=C(C(=O)OC)C(C(=O)OC)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C17H19NO6/c1-4-24-14-12(16(20)22-2)13(17(21)23-3)18(15(14)19)10-11-8-6-5-7-9-11/h5-9,13H,4,10H2,1-3H3 |
| InChIKey | NJLAIFKBZWPCKS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |