C23H22N2O — CID 134919617
(3S,4R)-1-benzyl-3-(N-methylanilino)-4-phenylazetidin-2-one (PubChem CID 134919617) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-(N-methylanilino)-4-phenylazetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-3-(N-methylanilino)-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 134919617 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3S,4R)-1-benzyl-3-(N-methylanilino)-4-phenylazetidin-2-one |
| SMILES | CN(c1ccccc1)[C@@H]1C(=O)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H22N2O/c1-24(20-15-9-4-10-16-20)22-21(19-13-7-3-8-14-19)25(23(22)26)17-18-11-5-2-6-12-18/h2-16,21-22H,17H2,1H3/t21-,22+/m1/s1 |
| InChIKey | KEWJPGJECTVAIR-YADHBBJMSA-N |
| XLogP | 4.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |