C29H26N2S — CID 24767043
(4S,5S)-1,3-dibenzyl-4,5-diphenylimidazolidine-2-thione (PubChem CID 24767043) has the molecular formula C29H26N2S and a molecular weight of 434.61 g/mol. Its IUPAC name is (4S,5S)-1,3-dibenzyl-4,5-diphenylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1,3-dibenzyl-4,5-diphenylimidazolidine-2-thione |
|---|---|
| PubChem CID | 24767043 |
| Molecular Formula | C29H26N2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (4S,5S)-1,3-dibenzyl-4,5-diphenylimidazolidine-2-thione |
| SMILES | S=C1N(Cc2ccccc2)[C@@H](c2ccccc2)[C@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C29H26N2S/c32-29-30(21-23-13-5-1-6-14-23)27(25-17-9-3-10-18-25)28(26-19-11-4-12-20-26)31(29)22-24-15-7-2-8-16-24/h1-20,27-28H,21-22H2/t27-,28-/m0/s1 |
| InChIKey | OORTYQSHVSEPIX-NSOVKSMOSA-N |
| XLogP | 6.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|