C17H18N2S — CID 170900554
(4R,5S)-1-benzyl-4-methyl-5-phenylimidazolidine-2-thione (PubChem CID 170900554) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is (4R,5S)-1-benzyl-4-methyl-5-phenylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-benzyl-4-methyl-5-phenylimidazolidine-2-thione |
|---|---|
| PubChem CID | 170900554 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (4R,5S)-1-benzyl-4-methyl-5-phenylimidazolidine-2-thione |
| SMILES | C[C@H]1NC(=S)N(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H18N2S/c1-13-16(15-10-6-3-7-11-15)19(17(20)18-13)12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3,(H,18,20)/t13-,16-/m1/s1 |
| InChIKey | PUPIIFBZLLNNHN-CZUORRHYSA-N |
| XLogP | 3.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|