C20H25ClN2 — CID 141084950
1,3-dibenzyl-2,4,5-trimethyl-2H-imidazole;hydrochloride (PubChem CID 141084950) has the molecular formula C20H25ClN2 and a molecular weight of 328.89 g/mol. Its IUPAC name is 1,3-dibenzyl-2,4,5-trimethyl-2H-imidazole;hydrochloride.
| Compound Name | 1,3-dibenzyl-2,4,5-trimethyl-2H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 141084950 |
| Molecular Formula | C20H25ClN2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1,3-dibenzyl-2,4,5-trimethyl-2H-imidazole;hydrochloride |
| SMILES | CC1=C(C)N(Cc2ccccc2)C(C)N1Cc1ccccc1.Cl |
| InChI | InChI=1S/C20H24N2.ClH/c1-16-17(2)22(15-20-12-8-5-9-13-20)18(3)21(16)14-19-10-6-4-7-11-19;/h4-13,18H,14-15H2,1-3H3;1H |
| InChIKey | QUTZUSOREROZON-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |