C17H17NOS — CID 15624083
(3R,4R)-1-benzyl-3-methyl-4-phenylsulfanylazetidin-2-one (PubChem CID 15624083) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-3-methyl-4-phenylsulfanylazetidin-2-one.
| Compound Name | (3R,4R)-1-benzyl-3-methyl-4-phenylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 15624083 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (3R,4R)-1-benzyl-3-methyl-4-phenylsulfanylazetidin-2-one |
| SMILES | C[C@@H]1C(=O)N(Cc2ccccc2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C17H17NOS/c1-13-16(19)18(12-14-8-4-2-5-9-14)17(13)20-15-10-6-3-7-11-15/h2-11,13,17H,12H2,1H3/t13-,17-/m1/s1 |
| InChIKey | APZKASWGTRGZIK-CXAGYDPISA-N |
| XLogP | 3.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |