C17H25NOS — CID 54068518
(3S,4R)-3-methyl-4-methylsulfanyl-1-(6-phenylhexyl)azetidin-2-one (PubChem CID 54068518) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is (3S,4R)-3-methyl-4-methylsulfanyl-1-(6-phenylhexyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-methyl-4-methylsulfanyl-1-(6-phenylhexyl)azetidin-2-one |
|---|---|
| PubChem CID | 54068518 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (3S,4R)-3-methyl-4-methylsulfanyl-1-(6-phenylhexyl)azetidin-2-one |
| SMILES | CS[C@@H]1[C@@H](C)C(=O)N1CCCCCCc1ccccc1 |
| InChI | InChI=1S/C17H25NOS/c1-14-16(19)18(17(14)20-2)13-9-4-3-6-10-15-11-7-5-8-12-15/h5,7-8,11-12,14,17H,3-4,6,9-10,13H2,1-2H3/t14-,17+/m0/s1 |
| InChIKey | METGVEYLFVLGKB-WMLDXEAASA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|