C17H25NO2S — CID 18781950
3-methyl-4-methylsulfinyl-1-(6-phenylhexyl)azetidin-2-one (PubChem CID 18781950) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is 3-methyl-4-methylsulfinyl-1-(6-phenylhexyl)azetidin-2-one.
| Compound Name | 3-methyl-4-methylsulfinyl-1-(6-phenylhexyl)azetidin-2-one |
|---|---|
| PubChem CID | 18781950 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 3-methyl-4-methylsulfinyl-1-(6-phenylhexyl)azetidin-2-one |
| SMILES | CC1C(=O)N(CCCCCCc2ccccc2)C1S(C)=O |
| InChI | InChI=1S/C17H25NO2S/c1-14-16(19)18(17(14)21(2)20)13-9-4-3-6-10-15-11-7-5-8-12-15/h5,7-8,11-12,14,17H,3-4,6,9-10,13H2,1-2H3 |
| InChIKey | YLOIUHZTBXSGKI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|