C22H26N2O2 — CID 165419017
(3R)-3-methyl-1-(2-phenylethyl)-4-(3-phenylpropyl)piperazine-2,5-dione (PubChem CID 165419017) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3R)-3-methyl-1-(2-phenylethyl)-4-(3-phenylpropyl)piperazine-2,5-dione.
| Compound Name | (3R)-3-methyl-1-(2-phenylethyl)-4-(3-phenylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 165419017 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (3R)-3-methyl-1-(2-phenylethyl)-4-(3-phenylpropyl)piperazine-2,5-dione |
| SMILES | C[C@@H]1C(=O)N(CCc2ccccc2)CC(=O)N1CCCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O2/c1-18-22(26)23(16-14-20-11-6-3-7-12-20)17-21(25)24(18)15-8-13-19-9-4-2-5-10-19/h2-7,9-12,18H,8,13-17H2,1H3/t18-/m1/s1 |
| InChIKey | GKWZZRFGPJTLDK-GOSISDBHSA-N |
| XLogP | 2.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |