C20H28N2O6 — CID 166600136
(3R)-4-(1,4-dioxepan-6-ylmethyl)-3-methyl-1-(2-phenylethyl)piperazine-2,5-dione;formic acid (PubChem CID 166600136) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is (3R)-4-(1,4-dioxepan-6-ylmethyl)-3-methyl-1-(2-phenylethyl)piperazine-2,5-dione;formic acid.
| Compound Name | (3R)-4-(1,4-dioxepan-6-ylmethyl)-3-methyl-1-(2-phenylethyl)piperazine-2,5-dione;formic acid |
|---|---|
| PubChem CID | 166600136 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (3R)-4-(1,4-dioxepan-6-ylmethyl)-3-methyl-1-(2-phenylethyl)piperazine-2,5-dione;formic acid |
| SMILES | C[C@@H]1C(=O)N(CCc2ccccc2)CC(=O)N1CC1COCCOC1.O=CO |
| InChI | InChI=1S/C19H26N2O4.CH2O2/c1-15-19(23)20(8-7-16-5-3-2-4-6-16)12-18(22)21(15)11-17-13-24-9-10-25-14-17;2-1-3/h2-6,15,17H,7-14H2,1H3;1H,(H,2,3)/t15-;/m1./s1 |
| InChIKey | KWEVOCUWRLBRKC-XFULWGLBSA-N |
| XLogP | 0.65 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|