C16H21ClN2O6S — CID 171322747
(3S)-1-[(2-chlorophenyl)methyl]-3-methyl-4-(2-methylsulfonylethyl)piperazine-2,5-dione;formic acid (PubChem CID 171322747) has the molecular formula C16H21ClN2O6S and a molecular weight of 404.87 g/mol. Its IUPAC name is (3S)-1-[(2-chlorophenyl)methyl]-3-methyl-4-(2-methylsulfonylethyl)piperazine-2,5-dione;formic acid.
| Compound Name | (3S)-1-[(2-chlorophenyl)methyl]-3-methyl-4-(2-methylsulfonylethyl)piperazine-2,5-dione;formic acid |
|---|---|
| PubChem CID | 171322747 |
| Molecular Formula | C16H21ClN2O6S |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (3S)-1-[(2-chlorophenyl)methyl]-3-methyl-4-(2-methylsulfonylethyl)piperazine-2,5-dione;formic acid |
| SMILES | C[C@H]1C(=O)N(Cc2ccccc2Cl)CC(=O)N1CCS(C)(=O)=O.O=CO |
| InChI | InChI=1S/C15H19ClN2O4S.CH2O2/c1-11-15(20)17(9-12-5-3-4-6-13(12)16)10-14(19)18(11)7-8-23(2,21)22;2-1-3/h3-6,11H,7-10H2,1-2H3;1H,(H,2,3)/t11-;/m0./s1 |
| InChIKey | CUOXWYMRZQCBRO-MERQFXBCSA-N |
| XLogP | 0.64 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|