C16H20ClFN2O4 — CID 166599363
(3S)-4-[(2-chloro-4-fluorophenyl)methyl]-3-methyl-1-propylpiperazine-2,5-dione;formic acid (PubChem CID 166599363) has the molecular formula C16H20ClFN2O4 and a molecular weight of 358.80 g/mol. Its IUPAC name is (3S)-4-[(2-chloro-4-fluorophenyl)methyl]-3-methyl-1-propylpiperazine-2,5-dione;formic acid.
| Compound Name | (3S)-4-[(2-chloro-4-fluorophenyl)methyl]-3-methyl-1-propylpiperazine-2,5-dione;formic acid |
|---|---|
| PubChem CID | 166599363 |
| Molecular Formula | C16H20ClFN2O4 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (3S)-4-[(2-chloro-4-fluorophenyl)methyl]-3-methyl-1-propylpiperazine-2,5-dione;formic acid |
| SMILES | CCCN1CC(=O)N(Cc2ccc(F)cc2Cl)[C@@H](C)C1=O.O=CO |
| InChI | InChI=1S/C15H18ClFN2O2.CH2O2/c1-3-6-18-9-14(20)19(10(2)15(18)21)8-11-4-5-12(17)7-13(11)16;2-1-3/h4-5,7,10H,3,6,8-9H2,1-2H3;1H,(H,2,3)/t10-;/m0./s1 |
| InChIKey | QFNACJCFJKTZGR-PPHPATTJSA-N |
| XLogP | 2.15 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|