C17H22ClFN2O2 — CID 165421903
(3S)-1-[(2-chlorophenyl)methyl]-4-(5-fluoropentyl)-3-methylpiperazine-2,5-dione (PubChem CID 165421903) has the molecular formula C17H22ClFN2O2 and a molecular weight of 340.83 g/mol. Its IUPAC name is (3S)-1-[(2-chlorophenyl)methyl]-4-(5-fluoropentyl)-3-methylpiperazine-2,5-dione.
| Compound Name | (3S)-1-[(2-chlorophenyl)methyl]-4-(5-fluoropentyl)-3-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 165421903 |
| Molecular Formula | C17H22ClFN2O2 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3S)-1-[(2-chlorophenyl)methyl]-4-(5-fluoropentyl)-3-methylpiperazine-2,5-dione |
| SMILES | C[C@H]1C(=O)N(Cc2ccccc2Cl)CC(=O)N1CCCCCF |
| InChI | InChI=1S/C17H22ClFN2O2/c1-13-17(23)20(11-14-7-3-4-8-15(14)18)12-16(22)21(13)10-6-2-5-9-19/h3-4,7-8,13H,2,5-6,9-12H2,1H3/t13-/m0/s1 |
| InChIKey | CPBNAZQRQMHQOI-ZDUSSCGKSA-N |
| XLogP | 3.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|