C14H17ClN2O5S — CID 110284461
2-[4-[(2-chlorophenyl)methyl]-1-methylsulfonyl-3-oxopiperazin-2-yl]acetic acid (PubChem CID 110284461) has the molecular formula C14H17ClN2O5S and a molecular weight of 360.82 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methyl]-1-methylsulfonyl-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[4-[(2-chlorophenyl)methyl]-1-methylsulfonyl-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 110284461 |
| Molecular Formula | C14H17ClN2O5S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methyl]-1-methylsulfonyl-3-oxopiperazin-2-yl]acetic acid |
| SMILES | CS(=O)(=O)N1CCN(Cc2ccccc2Cl)C(=O)C1CC(=O)O |
| InChI | InChI=1S/C14H17ClN2O5S/c1-23(21,22)17-7-6-16(14(20)12(17)8-13(18)19)9-10-4-2-3-5-11(10)15/h2-5,12H,6-9H2,1H3,(H,18,19) |
| InChIKey | LJSOIKPFTCGGKE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |