C20H21BrN2O3 — CID 110284156
2-[1-benzyl-4-[(3-bromophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid (PubChem CID 110284156) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is 2-[1-benzyl-4-[(3-bromophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-benzyl-4-[(3-bromophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 110284156 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-[1-benzyl-4-[(3-bromophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid |
| SMILES | O=C(O)CC1C(=O)N(Cc2cccc(Br)c2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H21BrN2O3/c21-17-8-4-7-16(11-17)14-23-10-9-22(13-15-5-2-1-3-6-15)18(20(23)26)12-19(24)25/h1-8,11,18H,9-10,12-14H2,(H,24,25) |
| InChIKey | WXNBLADBFYCRJT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |