C19H27BrClN3O2 — CID 110283633
3-[2-(azepan-1-yl)-2-oxoethyl]-1-[(3-bromophenyl)methyl]piperazin-2-one;hydrochloride (PubChem CID 110283633) has the molecular formula C19H27BrClN3O2 and a molecular weight of 444.80 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-1-[(3-bromophenyl)methyl]piperazin-2-one;hydrochloride.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-1-[(3-bromophenyl)methyl]piperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 110283633 |
| Molecular Formula | C19H27BrClN3O2 |
| Molecular Weight | 444.80 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-1-[(3-bromophenyl)methyl]piperazin-2-one;hydrochloride |
| SMILES | Cl.O=C(CC1NCCN(Cc2cccc(Br)c2)C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C19H26BrN3O2.ClH/c20-16-7-5-6-15(12-16)14-23-11-8-21-17(19(23)25)13-18(24)22-9-3-1-2-4-10-22;/h5-7,12,17,21H,1-4,8-11,13-14H2;1H |
| InChIKey | VJBFSXRATZQETP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |