C16H23BrClN3O3 — CID 110283661
2-[4-[(3-bromophenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide;hydrochloride (PubChem CID 110283661) has the molecular formula C16H23BrClN3O3 and a molecular weight of 420.74 g/mol. Its IUPAC name is 2-[4-[(3-bromophenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide;hydrochloride.
| Compound Name | 2-[4-[(3-bromophenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 110283661 |
| Molecular Formula | C16H23BrClN3O3 |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-[4-[(3-bromophenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide;hydrochloride |
| SMILES | COCCNC(=O)CC1NCCN(Cc2cccc(Br)c2)C1=O.Cl |
| InChI | InChI=1S/C16H22BrN3O3.ClH/c1-23-8-6-19-15(21)10-14-16(22)20(7-5-18-14)11-12-3-2-4-13(17)9-12;/h2-4,9,14,18H,5-8,10-11H2,1H3,(H,19,21);1H |
| InChIKey | ZJHIGMSVMRBHOP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|