C17H22ClN3O4S — CID 42653481
1-[(2-chlorophenyl)methyl]-4-(4-methylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 42653481) has the molecular formula C17H22ClN3O4S and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-4-(4-methylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-[(2-chlorophenyl)methyl]-4-(4-methylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 42653481 |
| Molecular Formula | C17H22ClN3O4S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-4-(4-methylsulfonylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | CS(=O)(=O)N1CCN(C(=O)C2CC(=O)N(Cc3ccccc3Cl)C2)CC1 |
| InChI | InChI=1S/C17H22ClN3O4S/c1-26(24,25)21-8-6-19(7-9-21)17(23)14-10-16(22)20(12-14)11-13-4-2-3-5-15(13)18/h2-5,14H,6-12H2,1H3 |
| InChIKey | FZVXJGSPKJOOCD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |