C20H26ClN3O3 — CID 48597700
4-[4-[2-(2-chlorophenyl)acetyl]piperazine-1-carbonyl]-1-propan-2-ylpyrrolidin-2-one (PubChem CID 48597700) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is 4-[4-[2-(2-chlorophenyl)acetyl]piperazine-1-carbonyl]-1-propan-2-ylpyrrolidin-2-one.
| Compound Name | 4-[4-[2-(2-chlorophenyl)acetyl]piperazine-1-carbonyl]-1-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 48597700 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 4-[4-[2-(2-chlorophenyl)acetyl]piperazine-1-carbonyl]-1-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)N1CC(C(=O)N2CCN(C(=O)Cc3ccccc3Cl)CC2)CC1=O |
| InChI | InChI=1S/C20H26ClN3O3/c1-14(2)24-13-16(12-19(24)26)20(27)23-9-7-22(8-10-23)18(25)11-15-5-3-4-6-17(15)21/h3-6,14,16H,7-13H2,1-2H3 |
| InChIKey | NCWAEEOFBWPKJG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |