C18H21FN2O4 — CID 110284377
2-[1-(cyclobutanecarbonyl)-4-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid (PubChem CID 110284377) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-[1-(cyclobutanecarbonyl)-4-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-(cyclobutanecarbonyl)-4-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 110284377 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[1-(cyclobutanecarbonyl)-4-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetic acid |
| SMILES | O=C(O)CC1C(=O)N(Cc2ccccc2F)CCN1C(=O)C1CCC1 |
| InChI | InChI=1S/C18H21FN2O4/c19-14-7-2-1-4-13(14)11-20-8-9-21(17(24)12-5-3-6-12)15(18(20)25)10-16(22)23/h1-2,4,7,12,15H,3,5-6,8-11H2,(H,22,23) |
| InChIKey | GNNBXGGWUHZADG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |