C20H25N3O5 — CID 166598811
(3S)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-methyl-1-(2-phenylethyl)piperazine-2,5-dione;formic acid (PubChem CID 166598811) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is (3S)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-methyl-1-(2-phenylethyl)piperazine-2,5-dione;formic acid.
| Compound Name | (3S)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-methyl-1-(2-phenylethyl)piperazine-2,5-dione;formic acid |
|---|---|
| PubChem CID | 166598811 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (3S)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-methyl-1-(2-phenylethyl)piperazine-2,5-dione;formic acid |
| SMILES | Cc1noc(C)c1CN1C(=O)CN(CCc2ccccc2)C(=O)[C@@H]1C.O=CO |
| InChI | InChI=1S/C19H23N3O3.CH2O2/c1-13-17(15(3)25-20-13)11-22-14(2)19(24)21(12-18(22)23)10-9-16-7-5-4-6-8-16;2-1-3/h4-8,14H,9-12H2,1-3H3;1H,(H,2,3)/t14-;/m0./s1 |
| InChIKey | MBSTWJAFWMHGOT-UQKRIMTDSA-N |
| XLogP | 1.79 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|