C19H28N2O2S — CID 70275870
2-[(2R,3R)-3-methyl-2-methylsulfanyl-4-oxoazetidin-1-yl]-N-(6-phenylhexyl)acetamide (PubChem CID 70275870) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 2-[(2R,3R)-3-methyl-2-methylsulfanyl-4-oxoazetidin-1-yl]-N-(6-phenylhexyl)acetamide.
| Compound Name | 2-[(2R,3R)-3-methyl-2-methylsulfanyl-4-oxoazetidin-1-yl]-N-(6-phenylhexyl)acetamide |
|---|---|
| PubChem CID | 70275870 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[(2R,3R)-3-methyl-2-methylsulfanyl-4-oxoazetidin-1-yl]-N-(6-phenylhexyl)acetamide |
| SMILES | CS[C@@H]1[C@H](C)C(=O)N1CC(=O)NCCCCCCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O2S/c1-15-18(23)21(19(15)24-2)14-17(22)20-13-9-4-3-6-10-16-11-7-5-8-12-16/h5,7-8,11-12,15,19H,3-4,6,9-10,13-14H2,1-2H3,(H,20,22)/t15-,19-/m1/s1 |
| InChIKey | OMOKEGXBZWOUPA-DNVCBOLYSA-N |
| XLogP | 3.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|