C23H36N2O3S — CID 18781987
2-(2-hexylsulfinyl-4-oxoazetidin-1-yl)-N-(6-phenylhexyl)acetamide (PubChem CID 18781987) has the molecular formula C23H36N2O3S and a molecular weight of 420.62 g/mol. Its IUPAC name is 2-(2-hexylsulfinyl-4-oxoazetidin-1-yl)-N-(6-phenylhexyl)acetamide.
| Compound Name | 2-(2-hexylsulfinyl-4-oxoazetidin-1-yl)-N-(6-phenylhexyl)acetamide |
|---|---|
| PubChem CID | 18781987 |
| Molecular Formula | C23H36N2O3S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2-(2-hexylsulfinyl-4-oxoazetidin-1-yl)-N-(6-phenylhexyl)acetamide |
| SMILES | CCCCCCS(=O)C1CC(=O)N1CC(=O)NCCCCCCc1ccccc1 |
| InChI | InChI=1S/C23H36N2O3S/c1-2-3-4-12-17-29(28)23-18-22(27)25(23)19-21(26)24-16-11-6-5-8-13-20-14-9-7-10-15-20/h7,9-10,14-15,23H,2-6,8,11-13,16-19H2,1H3,(H,24,26) |
| InChIKey | VSVFORSYPDTAPO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|