C24H28ClFN2O3S — CID 67586670
2-[(2R,3S)-2-benzylsulfinyl-3-chloro-4-oxoazetidin-1-yl]-N-[6-(4-fluorophenyl)hexyl]acetamide (PubChem CID 67586670) has the molecular formula C24H28ClFN2O3S and a molecular weight of 479.02 g/mol. Its IUPAC name is 2-[(2R,3S)-2-benzylsulfinyl-3-chloro-4-oxoazetidin-1-yl]-N-[6-(4-fluorophenyl)hexyl]acetamide.
| Compound Name | 2-[(2R,3S)-2-benzylsulfinyl-3-chloro-4-oxoazetidin-1-yl]-N-[6-(4-fluorophenyl)hexyl]acetamide |
|---|---|
| PubChem CID | 67586670 |
| Molecular Formula | C24H28ClFN2O3S |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[(2R,3S)-2-benzylsulfinyl-3-chloro-4-oxoazetidin-1-yl]-N-[6-(4-fluorophenyl)hexyl]acetamide |
| SMILES | O=C(CN1C(=O)[C@H](Cl)[C@H]1S(=O)Cc1ccccc1)NCCCCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H28ClFN2O3S/c25-22-23(30)28(24(22)32(31)17-19-9-5-3-6-10-19)16-21(29)27-15-7-2-1-4-8-18-11-13-20(26)14-12-18/h3,5-6,9-14,22,24H,1-2,4,7-8,15-17H2,(H,27,29)/t22-,24+,32?/m0/s1 |
| InChIKey | BLYLXEPBZKKQIU-CJOGBBIVSA-N |
| XLogP | 3.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|