C25H31FN2O3S — CID 19605386
N-[6-(4-fluorophenyl)hexyl]-2-[2-[(4-methoxyphenyl)methylsulfanyl]-4-oxoazetidin-1-yl]acetamide (PubChem CID 19605386) has the molecular formula C25H31FN2O3S and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[6-(4-fluorophenyl)hexyl]-2-[2-[(4-methoxyphenyl)methylsulfanyl]-4-oxoazetidin-1-yl]acetamide.
| Compound Name | N-[6-(4-fluorophenyl)hexyl]-2-[2-[(4-methoxyphenyl)methylsulfanyl]-4-oxoazetidin-1-yl]acetamide |
|---|---|
| PubChem CID | 19605386 |
| Molecular Formula | C25H31FN2O3S |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-[6-(4-fluorophenyl)hexyl]-2-[2-[(4-methoxyphenyl)methylsulfanyl]-4-oxoazetidin-1-yl]acetamide |
| SMILES | COc1ccc(CSC2CC(=O)N2CC(=O)NCCCCCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H31FN2O3S/c1-31-22-13-9-20(10-14-22)18-32-25-16-24(30)28(25)17-23(29)27-15-5-3-2-4-6-19-7-11-21(26)12-8-19/h7-14,25H,2-6,15-18H2,1H3,(H,27,29) |
| InChIKey | KZWCJRFXLXXQIB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|