C29H33FN2O4S — CID 139914925
2-(3-benzylsulfinyl-2-oxoazetidin-1-yl)-N-[6-(4-fluorophenyl)hexyl]-3-(furan-3-yl)propanamide (PubChem CID 139914925) has the molecular formula C29H33FN2O4S and a molecular weight of 524.66 g/mol. Its IUPAC name is 2-(3-benzylsulfinyl-2-oxoazetidin-1-yl)-N-[6-(4-fluorophenyl)hexyl]-3-(furan-3-yl)propanamide.
| Compound Name | 2-(3-benzylsulfinyl-2-oxoazetidin-1-yl)-N-[6-(4-fluorophenyl)hexyl]-3-(furan-3-yl)propanamide |
|---|---|
| PubChem CID | 139914925 |
| Molecular Formula | C29H33FN2O4S |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 2-(3-benzylsulfinyl-2-oxoazetidin-1-yl)-N-[6-(4-fluorophenyl)hexyl]-3-(furan-3-yl)propanamide |
| SMILES | O=C(NCCCCCCc1ccc(F)cc1)C(Cc1ccoc1)N1CC(S(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C29H33FN2O4S/c30-25-13-11-22(12-14-25)8-4-1-2-7-16-31-28(33)26(18-24-15-17-36-20-24)32-19-27(29(32)34)37(35)21-23-9-5-3-6-10-23/h3,5-6,9-15,17,20,26-27H,1-2,4,7-8,16,18-19,21H2,(H,31,33) |
| InChIKey | RYVRGPXYIQHROL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|